2,4-DCPEA
2-(2,4-Dichlorophenyl)ethan-1-amine
 10052 C8H9Cl2N 190.07
 InChI=1S/C8H9Cl2N/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5H,3-4,11H2
 VHJKDOLGYMULOP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1Cl)Cl