4-(2-Aminopropyl)-3-fluoro-N,N-dimethylaniline
 10050  C11H17FN2  196.264
 InChI=1S/C11H17FN2/c1-8(13)6-9-4-5-10(14(2)3)7-11(9)12/h4-5,7-8H,6,13H2,1-3H3
 XAXQLAAMKCCLNQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1F)N(C)C)N