2F-tyramine
4-(2-Aminoethyl)-3-fluorophenol
 10049 C8H10FNO 155.17
 InChI=1S/C8H10FNO/c9-8-5-7(11)2-1-6(8)3-4-10/h1-2,5,11H,3-4,10H2
 VNJHWFPYBFFKMD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1F)O