1-(3,5-Dimethoxyphenyl)-N-methylpent-4-en-2-amine
 10015 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-5-6-12(15-2)7-11-8-13(16-3)10-14(9-11)17-4/h5,8-10,12,15H,1,6-7H2,2-4H3
 WKDNZYNYQASCMB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1cc(OC)cc(c1)OC)CC=C