1-(2,6-Dimethoxyphenyl)-N-methylpent-4-en-2-amine
 10000 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-5-7-11(15-2)10-12-13(16-3)8-6-9-14(12)17-4/h5-6,8-9,11,15H,1,7,10H2,2-4H3
 PUEKZVWWPYNGFW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1c(OC)cccc1OC)CC=C