5-BPDi
1-(2,3-Dihydro-1H-inden-5-yl)-2-(pyrrolidin-1-yl)hexan-1-one
 1000 C19H27NO 285.424
 InChI=1S/C19H27NO/c1-2-3-9-18(20-12-4-5-13-20)19(21)17-11-10-15-7-6-8-16(15)14-17/h10-11,14,18H,2-9,12-13H2,1H3
 WETQQOQCDBNIKE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCC(C(=O)c1ccc2c(c1)CCC2)N1CCCC1