N-Me-3-TFMA
N-Methyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine
 9842 C11H14F3N 217.231
 InChI=1S/C11H14F3N/c1-8(15-2)6-9-4-3-5-10(7-9)11(12,13)14/h3-5,7-8,15H,6H2,1-2H3
 WAUORSZPKUHOSM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1cccc(c1)C(F)(F)F)C