3-TFM-phentermine
2-Methyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine
 9841 C11H14F3N 217.231
 InChI=1S/C11H14F3N/c1-10(2,15)7-8-4-3-5-9(6-8)11(12,13)14/h3-6H,7,15H2,1-2H3
 CUEVAAQJHCRHJI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1)C(F)(F)F)(N)C