1-[3-(Trifluoromethyl)phenyl]butan-2-amine
 9840 C11H14F3N 217.231
 InChI=1S/C11H14F3N/c1-2-10(15)7-8-4-3-5-9(6-8)11(12,13)14/h3-6,10H,2,7,15H2,1H3
 PGSHQQWAARQLIC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1cccc(c1)C(F)(F)F)N