homo-Norfenfluramine
4-[3-(Trifluoromethyl)phenyl]butan-2-amine
 9839 C11H14F3N 217.231
 InChI=1S/C11H14F3N/c1-8(15)5-6-9-3-2-4-10(7-9)11(12,13)14/h2-4,7-8H,5-6,15H2,1H3
 QPVLCHKIGUQAOL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(CCc1cccc(c1)C(F)(F)F)N