N-(4-Methylbenzyl)methamphetamine
N-Methyl-N-[(4-methylphenyl)methyl]-1-phenylpropan-2-amine
 9824 C18H23N 253.382
 InChI=1S/C18H23N/c1-15-9-11-18(12-10-15)14-19(3)16(2)13-17-7-5-4-6-8-17/h4-12,16H,13-14H2,1-3H3
 HKVKXNRVEUNUSE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccccc1)C)Cc1ccc(cc1)C