N-(4-Methylbenzyl)amphetamine
N-[(4-Methylphenyl)methyl]-1-phenylpropan-2-amine
 9823 C17H21N 239.355
 InChI=1S/C17H21N/c1-14-8-10-17(11-9-14)13-18-15(2)12-16-6-4-3-5-7-16/h3-11,15,18H,12-13H2,1-2H3
 NVACDMAZYBOQOE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCc1ccc(cc1)C