4-(Naphthalen-2-yl)-1-propylpiperidine
 9720 C18H23N 253.382
 InChI=1S/C18H23N/c1-2-11-19-12-9-16(10-13-19)18-8-7-15-5-3-4-6-17(15)14-18/h3-8,14,16H,2,9-13H2,1H3
 JPFBKWSBTOFTQU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN1CCC(CC1)c1ccc2c(c1)cccc2