1-(2-{5-Chloro-2-[(prop-2-en-1-yl)oxy]phenyl}cyclopropyl)methanamine
 9642 C13H16ClNO 237.725
 InChI=1S/C13H16ClNO/c1-2-5-16-13-4-3-10(14)7-12(13)11-6-9(11)8-15/h2-4,7,9,11H,1,5-6,8,15H2
 QOANYWUWQDIUIF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCOc1ccc(cc1C1CC1CN)Cl