A-NPI
N-(1-Phenylpropan-2-yl)propan-2-imine
 9578 C12H17N 175.27
 InChI=1S/C12H17N/c1-10(2)13-11(3)9-12-7-5-4-6-8-12/h4-8,11H,9H2,1-3H3
 CRYROJKTHRWYCW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)N=C(C)C