PCPyrrole
1-(1-Phenylcyclohexyl)-1H-pyrrole
 9546 C16H19N 225.329
 Arylcycloalkylamine
 InChI=1S/C16H19N/c1-3-9-15(10-4-1)16(11-5-2-6-12-16)17-13-7-8-14-17/h1,3-4,7-10,13-14H,2,5-6,11-12H2
 VNGWITCXLFXYBC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CCC(CC1)(c1ccccc1)n1cccc1