Propynyl-CP
1-[1-(Prop-1-yn-1-yl)cyclohexyl]piperidine
 9544 C14H23N 205.339
 Arylcycloalkylamine
 InChI=1S/C14H23N/c1-2-9-14(10-5-3-6-11-14)15-12-7-4-8-13-15/h3-8,10-13H2,1H3
 ZDMURAJUVKMQDR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC#CC1(CCCCC1)N1CCCCC1