(4E)-4-Methyl-5-phenylpent-4-en-2-amine
 9311 C12H17N 175.27
 InChI=1S/C12H17N/c1-10(8-11(2)13)9-12-6-4-3-5-7-12/h3-7,9,11H,8,13H2,1-2H3/b10-9+
 BYKSESWBPAGIOI-MDZDMXLPSA-N This stereoisomer Any stereoisomer
 CC(C/C(=C/c1ccccc1)/C)N