2-EtO-N,α-Me-PEA
1-(2-Ethoxyphenyl)-N-methylpropan-2-amine
 9019 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-14-12-8-6-5-7-11(12)9-10(2)13-3/h5-8,10,13H,4,9H2,1-3H3
 YVOWQHXRSJUJGT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccccc1CC(NC)C