3-MeO-N,α,2-Me-PEA
1-(3-Methoxy-2-methylphenyl)-N-methylpropan-2-amine
 8999 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9(13-3)8-11-6-5-7-12(14-4)10(11)2/h5-7,9,13H,8H2,1-4H3
 BWVXSJXWYDSQLL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1cccc(c1C)OC)C