2-MeO-N,α,6-Me-PEA
1-(2-Methoxy-6-methylphenyl)-N-methylpropan-2-amine
 8998 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9-6-5-7-12(14-4)11(9)8-10(2)13-3/h5-7,10,13H,8H2,1-4H3
 WSQWZUAKLNDZQT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1c(C)cccc1OC)C