2-MeO-N,α,5-Me-PEA
1-(2-Methoxy-5-methylphenyl)-N-methylpropan-2-amine
 8997 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-9-5-6-12(14-4)11(7-9)8-10(2)13-3/h5-7,10,13H,8H2,1-4H3
 AROQULDDWILMBR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1cc(C)ccc1OC)C