2-MeO-N,N,4-Me-PEA
2-(2-Methoxy-4-methylphenyl)-N,N-dimethylethan-1-amine
 8964 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-10-5-6-11(7-8-13(2)3)12(9-10)14-4/h5-6,9H,7-8H2,1-4H3
 AEOCJIWNSPGZEL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)ccc1CCN(C)C