(Cyclobutyl) 4-MA
1-[1-(4-Methylphenyl)cyclobutyl]ethan-1-amine
 8665 C13H19N 189.297
 InChI=1S/C13H19N/c1-10-4-6-12(7-5-10)13(11(2)14)8-3-9-13/h4-7,11H,3,8-9,14H2,1-2H3
 BVEQKUZVLUBDDU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1ccc(cc1)C1(CCC1)C(N)C