4-MeBnAPB
2-(Benzylamino)-1-(4-methylphenyl)butan-1-one
 8572  C18H21NO  267.365
 InChI=1S/C18H21NO/c1-3-17(19-13-15-7-5-4-6-8-15)18(20)16-11-9-14(2)10-12-16/h4-12,17,19H,3,13H2,1-2H3
 ZWTIKPPAPCJQNP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(C(=O)c1ccc(cc1)C)NCc1ccccc1