4,6-Me-2-EPEA
2-(2-Ethoxy-4,6-dimethylphenyl)ethan-1-amine
 7803 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-14-12-8-9(2)7-10(3)11(12)5-6-13/h7-8H,4-6,13H2,1-3H3
 ZYTHVLKFOWGQHM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OCC)cc(cc1C)C