N-Formyl-methamphetamine
N-Methyl-N-(1-phenylpropan-2-yl)formamide
 7475 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-10(12(2)9-13)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3
 GLSMSUZWTDVJMA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=CN(C(Cc1ccccc1)C)C