ALEPH-S-PhEt
1-{2,5-Dimethoxy-4-[(2-phenylethyl)sulfanyl]phenyl}propan-2-amine
 7415  C19H25NO2S  331.472
 InChI=1S/C19H25NO2S/c1-14(20)11-16-12-18(22-3)19(13-17(16)21-2)23-10-9-15-7-5-4-6-8-15/h4-8,12-14H,9-11,20H2,1-3H3
 DLCYMWYHXKNVOC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(cc1SCCc1ccccc1)OC