Fenethylline
1,3-Dimethyl-7-{2-[(1-phenylpropan-2-yl)amino]ethyl}-3,7-dihydro-1H-purine-2,6-dione
 724 C18H23N5O2 341.408
 InChI=1S/C18H23N5O2/c1-13(11-14-7-5-4-6-8-14)19-9-10-23-12-20-16-15(23)17(24)22(3)18(25)21(16)2/h4-8,12-13,19H,9-11H2,1-3H3
 NMCHYWGKBADVMK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCCn1cnc2c1c(=O)n(C)c(=O)n2C