PAPEA
4-(2-Aminoethyl)aniline
 6227 C8H12N2 136.194
 InChI=1S/C8H12N2/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6,9-10H2
 LNPMZQXEPNWCMG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1)N