N-iPr-PCA
1-(4-Chlorophenyl)-N-(propan-2-yl)propan-2-amine
 6218 C12H18ClN 211.731
 InChI=1S/C12H18ClN/c1-9(2)14-10(3)8-11-4-6-12(13)7-5-11/h4-7,9-10,14H,8H2,1-3H3
 XNQNLAUGNIZWKJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)Cl)NC(C)C