N-Isopropylhomotryptamine
3-(1H-Indol-3-yl)-N-(propan-2-yl)propan-1-amine
 5742 C14H20N2 216.322
 InChI=1S/C14H20N2/c1-11(2)15-9-5-6-12-10-16-14-8-4-3-7-13(12)14/h3-4,7-8,10-11,15-16H,5-6,9H2,1-2H3
 UJDVDORLLUMQRC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NCCCc1c[nH]c2c1cccc2)C