7-HO-DMT
3-[2-(Dimethylamino)ethyl]-1H-indol-7-ol
 5208 C12H16N2O 204.268
 InChI=1S/C12H16N2O/c1-14(2)7-6-9-8-13-12-10(9)4-3-5-11(12)15/h3-5,8,13,15H,6-7H2,1-2H3
 FZFHBMMTKKWEQH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1c[nH]c2c1cccc2O)C