TFMMA
N-Methyl-1-[4-(trifluoromethyl)phenyl]propan-2-amine
 519 C11H14F3N 217.231
 InChI=1S/C11H14F3N/c1-8(15-2)7-9-3-5-10(6-4-9)11(12,13)14/h3-6,8,15H,7H2,1-2H3
 MUOZNHDFXWQUSN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc(cc1)C(F)(F)F)C