3-HO-CPDMA
3-[2-(Dimethylamino)cyclopropyl]phenol
 513 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-12(2)11-7-10(11)8-4-3-5-9(13)6-8/h3-6,10-11,13H,7H2,1-2H3
 LYTWDOIYZATBOZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C1CC1c1cccc(c1)O)C