2-HO-CPDMA
2-[2-(Dimethylamino)cyclopropyl]phenol
 507 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-12(2)10-7-9(10)8-5-3-4-6-11(8)13/h3-6,9-10,13H,7H2,1-2H3
 BVUOMRJSZWYZMF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C1CC1c1ccccc1O)C