N-Ethyl-N-methyl-1,2-diphenylethanamine
N-Ethyl-N-methyl-1,2-diphenylethan-1-amine
 3971 C17H21N 239.355
 InChI=1S/C17H21N/c1-3-18(2)17(16-12-8-5-9-13-16)14-15-10-6-4-7-11-15/h4-13,17H,3,14H2,1-2H3
 MJDUDHAPJCKZPF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(c1ccccc1)Cc1ccccc1)C