Tropinone
8-Methyl-8-azabicyclo[3.2.1]octan-3-one
 3857 C8H13NO 139.195
 InChI=1S/C8H13NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-7H,2-5H2,1H3
 QQXLDOJGLXJCSE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1C2CCC1CC(=O)C2