4-Ethylephedrine
1-(4-Ethylphenyl)-2-(methylamino)propan-1-ol
 2996 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-10-5-7-11(8-6-10)12(14)9(2)13-3/h5-9,12-14H,4H2,1-3H3
 MMTHSVQWQJSUJY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccc(cc1)CC)O)C