Iso-phenmetrazine
5-Methyl-2-phenylmorpholine
 2974 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-9-8-13-11(7-12-9)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3
 LQHGEOIBMBXJGV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1NCC(OC1)c1ccccc1