7-[(3-Methoxyphenyl)methyl]-2,3,4,5-tetrahydro-1H-3-benzazepine
 2929 C18H21NO 267.365
 InChI=1S/C18H21NO/c1-20-18-4-2-3-14(13-18)11-15-5-6-16-7-9-19-10-8-17(16)12-15/h2-6,12-13,19H,7-11H2,1H3
 VZPOCFITBFUUFE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cccc(c1)Cc1ccc2c(c1)CCNCC2