1-[(E)-(2-Chlorophenyl)(methylimino)methyl]cyclopentan-1-ol
 2825 C13H16ClNO 237.725
 InChI=1S/C13H16ClNO/c1-15-12(13(16)8-4-5-9-13)10-6-2-3-7-11(10)14/h2-3,6-7,16H,4-5,8-9H2,1H3/b15-12+
 FJGPXUPMNZOTLX-NTCAYCPXSA-N This stereoisomer Any stereoisomer
 C/N=C(/C1(O)CCCC1)\c1ccccc1Cl