N-(1-Phenylethyl)-N-(1-phenylpropan-2-yl)formamide
 2758  C18H21NO  267.365
 InChI=1S/C18H21NO/c1-15(13-17-9-5-3-6-10-17)19(14-20)16(2)18-11-7-4-8-12-18/h3-12,14-16H,13H2,1-2H3
 BXWRURSTCOJSEZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=CN(C(c1ccccc1)C)C(Cc1ccccc1)C