Benzylmorpholine
4-Benzylmorpholine
 2677 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h1-5H,6-10H2
 GVWBJJLCTWNTRU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O1CCN(CC1)Cc1ccccc1