5-Me-MET
N-Ethyl-N-methyl-2-(5-methyl-1H-indol-3-yl)ethan-1-amine
 2655 C14H20N2 216.322
 InChI=1S/C14H20N2/c1-4-16(3)8-7-12-10-15-14-6-5-11(2)9-13(12)14/h5-6,9-10,15H,4,7-8H2,1-3H3
 JJZIDRIZYSPYFB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c[nH]c2c1cc(C)cc2)C