MPEP
1-(1-Phenylpropan-2-yl)pyrrolidine
 2639 C13H19N 189.297
 InChI=1S/C13H19N/c1-12(14-9-5-6-10-14)11-13-7-3-2-4-8-13/h2-4,7-8,12H,5-6,9-11H2,1H3
 AWNZMWZMSDWFCV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N1CCCC1)Cc1ccccc1