Desmethylselegiline
N-(1-Phenylpropan-2-yl)prop-2-yn-1-amine
 2531  C12H15N  173.254
 InChI=1S/C12H15N/c1-3-9-13-11(2)10-12-7-5-4-6-8-12/h1,4-8,11,13H,9-10H2,2H3
 UUFAJPMQSFXDFR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NCC#C