Benzphetamine
N-Benzyl-N-methyl-1-phenylpropan-2-amine
 2529 C17H21N 239.355
 InChI=1S/C17H21N/c1-15(13-16-9-5-3-6-10-16)18(2)14-17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3
 YXKTVDFXDRQTKV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccccc1)C)Cc1ccccc1