Isoethcathinone
1-(Ethylamino)-1-phenylpropan-2-one
 2526 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-3-12-11(9(2)13)10-7-5-4-6-8-10/h4-8,11-12H,3H2,1-2H3
 GHVCNLDRNVGRJP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(c1ccccc1)C(=O)C