4-MeO-N,N,3-MePEA
2-(4-Methoxy-3-methylphenyl)-N,N-dimethylethan-1-amine
 2524 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-10-9-11(7-8-13(2)3)5-6-12(10)14-4/h5-6,9H,7-8H2,1-4H3
 FNWVODZYQWVHHP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1C)CCN(C)C